Products 1344557-92-1
CAS 1344557-92-1 is the registry number for (S)-(2-(1-aminoethyl)phenyl)(4-bromophenyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[(1S)-1-aminoethyl]phenyl]-(4-bromophenyl)methanone (CAS 1344557-92-1) is a chemical compound with the molecular formula C15H14BrNO and a molecular weight of 304.18 g/mol. IUPAC name: [2-[(1S)-1-aminoethyl]phenyl]-(4-bromophenyl)methanone. InChIKey: SUYFYFAONIGTQJ-JTQLQIEISA-N.
| Molecular formula | C15H14BrNO |
|---|---|
| Molecular weight | 304.18 g/mol |
| IUPAC name | [2-[(1S)-1-aminoethyl]phenyl]-(4-bromophenyl)methanone |
| InChIKey | SUYFYFAONIGTQJ-JTQLQIEISA-N |
| SMILES | C[C@@H](C1=CC=CC=C1C(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)