CAS 1880982-15-9 is the registry number for N-Benzyl-2-bromo-6-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-benzyl-2-bromo-6-methylbenzamide (CAS 1880982-15-9) is a chemical compound with the molecular formula C15H14BrNO and a molecular weight of 304.18 g/mol. IUPAC name: N-benzyl-2-bromo-6-methylbenzamide. InChIKey: SXDMWUMTQIGVJH-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO |
|---|---|
| Molecular weight | 304.18 g/mol |
| IUPAC name | N-benzyl-2-bromo-6-methylbenzamide |
| InChIKey | SXDMWUMTQIGVJH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Br)C(=O)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)