CAS 195383-89-2 appears in our catalog under these names: N-(2,6-Dimethylphenyl) 2-bromobenzamide, 98%, 2-Bromo-N-(2,6-dimethylphenyl)benzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
2-bromo-N-(2,6-dimethylphenyl)benzamide (CAS 195383-89-2) is a chemical compound with the molecular formula C15H14BrNO and a molecular weight of 304.18 g/mol. IUPAC name: 2-bromo-N-(2,6-dimethylphenyl)benzamide. InChIKey: FONQPWFYFWAITH-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO |
|---|---|
| Molecular weight | 304.18 g/mol |
| IUPAC name | 2-bromo-N-(2,6-dimethylphenyl)benzamide |
| InChIKey | FONQPWFYFWAITH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)