CAS 303991-53-9 appears in our catalog under these names: N-(3,4-Dimethylphenyl) 2-bromobenzamide, 98%, 2-Bromo-N-(3,4-dimethylphenyl)benzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 500g, 5g.
2-bromo-N-(3,4-dimethylphenyl)benzamide (CAS 303991-53-9) is a chemical compound with the molecular formula C15H14BrNO and a molecular weight of 304.18 g/mol. IUPAC name: 2-bromo-N-(3,4-dimethylphenyl)benzamide. InChIKey: IDLSRDSIECGYON-UHFFFAOYSA-N.
| Molecular formula | C15H14BrNO |
|---|---|
| Molecular weight | 304.18 g/mol |
| IUPAC name | 2-bromo-N-(3,4-dimethylphenyl)benzamide |
| InChIKey | IDLSRDSIECGYON-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2Br)C |
Computed by PubChem (NCBI)