CAS 1344709-24-5 is the registry number for 1-Hydroxy-5-oxo-5,6,7,8-tetrahydronaphthalene-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-hydroxy-5-oxo-7,8-dihydro-6H-naphthalene-2-carbonitrile (CAS 1344709-24-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-hydroxy-5-oxo-7,8-dihydro-6H-naphthalene-2-carbonitrile. InChIKey: DLMQVQWFIZSYCF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-hydroxy-5-oxo-7,8-dihydro-6H-naphthalene-2-carbonitrile |
| InChIKey | DLMQVQWFIZSYCF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2O)C#N)C(=O)C1 |
Computed by PubChem (NCBI)