CAS 1344895-14-2 is the registry number for 6-Hydroxy-8-nitrochroman-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-hydroxy-8-nitro-2,3-dihydrochromen-4-one (CAS 1344895-14-2) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: 6-hydroxy-8-nitro-2,3-dihydrochromen-4-one. InChIKey: SAPHSBTVTQBIRV-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 6-hydroxy-8-nitro-2,3-dihydrochromen-4-one |
| InChIKey | SAPHSBTVTQBIRV-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)