Products 134541-02-9

CAS 134541-02-9 is the registry number for Diethyl Isoxazole-4,5-dicarboxylate, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 250mg, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Diethyl 1,2-oxazole-4,5-dicarboxylate (CAS 134541-02-9) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: diethyl 1,2-oxazole-4,5-dicarboxylate. InChIKey: TXJZEIDFVVLPHP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO5
Molecular weight213.19 g/mol
IUPAC namediethyl 1,2-oxazole-4,5-dicarboxylate
InChIKeyTXJZEIDFVVLPHP-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(ON=C1)C(=O)OCC

Computed by PubChem (NCBI)