CAS 1345456-44-1 is the registry number for tert-Butyl (R)-3-(aminomethyl)-3-fluoropiperidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg, 1g.
Tert-butyl (3R)-3-(aminomethyl)-3-fluoropiperidine-1-carboxylate (CAS 1345456-44-1) is a chemical compound with the molecular formula C11H21FN2O2 and a molecular weight of 232.29 g/mol. IUPAC name: tert-butyl (3R)-3-(aminomethyl)-3-fluoropiperidine-1-carboxylate. InChIKey: QLSJCALZHFNFAL-LLVKDONJSA-N.
| Molecular formula | C11H21FN2O2 |
|---|---|
| Molecular weight | 232.29 g/mol |
| IUPAC name | tert-butyl (3R)-3-(aminomethyl)-3-fluoropiperidine-1-carboxylate |
| InChIKey | QLSJCALZHFNFAL-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](C1)(CN)F |
Computed by PubChem (NCBI)