CAS 1345471-19-3 is the registry number for 6-Bromo-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-bromo-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine (CAS 1345471-19-3) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 6-bromo-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: SVQYBLHUCPEMDG-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 6-bromo-3-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | SVQYBLHUCPEMDG-UHFFFAOYSA-N |
| SMILES | CC1COC2=C(C(=CC=C2)Br)OC1 |
Computed by PubChem (NCBI)