CAS 1345471-96-6 is the registry number for 4-(3-Chloro-5-fluorophenyl)aniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3-chloro-5-fluorophenyl)aniline (CAS 1345471-96-6) is a chemical compound with the molecular formula C12H9ClFN and a molecular weight of 221.66 g/mol. IUPAC name: 4-(3-chloro-5-fluorophenyl)aniline. InChIKey: FSXLTSAXLFETHZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFN |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 4-(3-chloro-5-fluorophenyl)aniline |
| InChIKey | FSXLTSAXLFETHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2)Cl)F)N |
Computed by PubChem (NCBI)