CAS 863921-61-3 is the registry number for 4'-Chloro-3'-fluoro-biphenyl-4-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(4-chloro-3-fluorophenyl)aniline (CAS 863921-61-3) is a chemical compound with the molecular formula C12H9ClFN and a molecular weight of 221.66 g/mol. IUPAC name: 4-(4-chloro-3-fluorophenyl)aniline. InChIKey: WKFBSNCXBGEYGG-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFN |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 4-(4-chloro-3-fluorophenyl)aniline |
| InChIKey | WKFBSNCXBGEYGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)Cl)F)N |
Computed by PubChem (NCBI)