CAS 577954-86-0 appears in our catalog under these names: 3'-Chloro-4'-fluoro-[1,1'-biphenyl]-2-amine 97%, 3'-Chloro-4'-fluoro-[1,1'-biphenyl]-2-amine, 97%, 97%, 3'-Chloro-4'-fluoro-[1,1'-biphenyl]-2-amine, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(3-chloro-4-fluorophenyl)aniline (CAS 577954-86-0) is a chemical compound with the molecular formula C12H9ClFN and a molecular weight of 221.66 g/mol. IUPAC name: 2-(3-chloro-4-fluorophenyl)aniline. InChIKey: QBVDQOUVCUSMQZ-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFN |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 2-(3-chloro-4-fluorophenyl)aniline |
| InChIKey | QBVDQOUVCUSMQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)F)Cl)N |
Computed by PubChem (NCBI)