CAS 188731-34-2 appears in our catalog under these names: 2-(4-Chlorophenyl)-4-fluoroaniline, 95%, 4'-Chloro-5-fluoro-1,1'-biphenyl-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(4-chlorophenyl)-4-fluoroaniline (CAS 188731-34-2) is a chemical compound with the molecular formula C12H9ClFN and a molecular weight of 221.66 g/mol. IUPAC name: 2-(4-chlorophenyl)-4-fluoroaniline. InChIKey: IIOKEAUIKKVDHM-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFN |
|---|---|
| Molecular weight | 221.66 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4-fluoroaniline |
| InChIKey | IIOKEAUIKKVDHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=CC(=C2)F)N)Cl |
Computed by PubChem (NCBI)