Products 1345674-93-2
CAS 1345674-93-2 is the registry number for Callophycin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(4-hydroxyphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (CAS 1345674-93-2) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: 2-[(4-hydroxyphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid. InChIKey: FWSRKMKBCXSLMT-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-[(4-hydroxyphenyl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | FWSRKMKBCXSLMT-UHFFFAOYSA-N |
| SMILES | C1C(N(CC2=C1C3=CC=CC=C3N2)CC4=CC=C(C=C4)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Callophycin A