CAS 1345866-68-3 appears in our catalog under these names: (4-(1,2,4,5-TETRAZIN-3-YL)PHENYL)METHAN&, (4-(1,2,4,5-Tetrazin-3-yl)phenyl)methanamine Hydrochloride, (4-(1,2,4,5-Tetrazin-3-yl)phenyl)methanamine hydrochloride (1:?), 95%, 95%. Offered by: Sigma-Aldrich, TRC, Biosynth, Chemat. Available pack sizes: 10MG, 25MG, 100mg, 50mg, 5mg, 250mg, 1g.
[4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride (CAS 1345866-68-3) is a chemical compound with the molecular formula C9H10ClN5 and a molecular weight of 223.66 g/mol. IUPAC name: [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride. InChIKey: FAAUXGMWUKVOPI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN5 |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride |
| InChIKey | FAAUXGMWUKVOPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=NN=CN=N2.Cl |
Computed by PubChem (NCBI)