CAS 897936-32-2 is the registry number for 2-Chloro-6-(pyrrolidin-1-yl)-9H-purine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
2-chloro-6-pyrrolidin-1-yl-7H-purine (CAS 897936-32-2) is a chemical compound with the molecular formula C9H10ClN5 and a molecular weight of 223.66 g/mol. IUPAC name: 2-chloro-6-pyrrolidin-1-yl-7H-purine. InChIKey: IJNYLLRNMGTTEC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN5 |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 2-chloro-6-pyrrolidin-1-yl-7H-purine |
| InChIKey | IJNYLLRNMGTTEC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC(=NC3=C2NC=N3)Cl |
Computed by PubChem (NCBI)