CAS 1416711-59-5 appears in our catalog under these names: (4-(1,2,4,5-Tetrazin-3-yl)phenyl)methanamine Monohydrochloride, (4–(1,2,4,5–Tetrazin–3–yl)phenyl)methanamine hydrochloride, Tetrazine–Amine monohydrochloride, [4-(1,2,4,5-Tetrazin-3-yl)phenyl]methanamine Hydrochloride, >95.0%(HPLC)(qNMR), (4-(1,2,4,5-Tetrazin-3-yl)phenyl)methanamine hydrochloride, 98%, 98%. Offered by: TRC, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 500mg, 1g, 5g, 25 mg, 100 mg.
[4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride (CAS 1416711-59-5) is a chemical compound with the molecular formula C9H10ClN5 and a molecular weight of 223.66 g/mol. IUPAC name: [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride. InChIKey: FAAUXGMWUKVOPI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN5 |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | [4-(1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride |
| InChIKey | FAAUXGMWUKVOPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=NN=CN=N2.Cl |
Computed by PubChem (NCBI)