CAS 6011-10-5 is the registry number for N-Phenyl-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-N-phenyl-1,3,5-triazine-2,4-diamine;hydrochloride (CAS 6011-10-5) is a chemical compound with the molecular formula C9H10ClN5 and a molecular weight of 223.66 g/mol. IUPAC name: 2-N-phenyl-1,3,5-triazine-2,4-diamine;hydrochloride. InChIKey: YTCPXXCJMMXWPM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN5 |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 2-N-phenyl-1,3,5-triazine-2,4-diamine;hydrochloride |
| InChIKey | YTCPXXCJMMXWPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=NC(=N2)N.Cl |
Computed by PubChem (NCBI)