Products 13459-62-6
CAS 13459-62-6 appears in our catalog under these names: 2–(2–((4–chlorophenyl)thio)phenyl)acetic acid, 2-(2-((4-chlorophenyl)thio)phenyl)acetic acid, 2-(2-((4-Chlorophenyl)thio)phenyl)acetic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g.
2-[2-(4-chlorophenyl)sulfanylphenyl]acetic acid (CAS 13459-62-6) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)sulfanylphenyl]acetic acid. InChIKey: WZICWIASCZNZHO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2S |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)sulfanylphenyl]acetic acid |
| InChIKey | WZICWIASCZNZHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)