CAS 30082-41-8 is the registry number for 3-{((4-Chlorophenyl)sulfanyl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid (CAS 30082-41-8) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid. InChIKey: SMSWCDAPANKIOU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2S |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid |
| InChIKey | SMSWCDAPANKIOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CSC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)