Products 30082-41-8

CAS 30082-41-8 is the registry number for 3-{((4-Chlorophenyl)sulfanyl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid (CAS 30082-41-8) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid. InChIKey: SMSWCDAPANKIOU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO2S
Molecular weight278.8 g/mol
IUPAC name3-[(4-chlorophenyl)sulfanylmethyl]benzoic acid
InChIKeySMSWCDAPANKIOU-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)CSC2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)