Products 40183-35-5

CAS 40183-35-5 is the registry number for 2-(Benzylthio)-4-chlorobenzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

2-benzylsulfanyl-4-chlorobenzoic acid (CAS 40183-35-5) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 2-benzylsulfanyl-4-chlorobenzoic acid. InChIKey: ZLLBKTJBNKYXRY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO2S
Molecular weight278.8 g/mol
IUPAC name2-benzylsulfanyl-4-chlorobenzoic acid
InChIKeyZLLBKTJBNKYXRY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CSC2=C(C=CC(=C2)Cl)C(=O)O

Computed by PubChem (NCBI)