CAS 40183-35-5 is the registry number for 2-(Benzylthio)-4-chlorobenzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2-benzylsulfanyl-4-chlorobenzoic acid (CAS 40183-35-5) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 2-benzylsulfanyl-4-chlorobenzoic acid. InChIKey: ZLLBKTJBNKYXRY-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2S |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | 2-benzylsulfanyl-4-chlorobenzoic acid |
| InChIKey | ZLLBKTJBNKYXRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)