Products 54506-81-9

CAS 54506-81-9 is the registry number for 2-((4-Chlorophenyl)sulfanyl)-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-(4-chlorophenyl)sulfanyl-5-methylbenzoic acid (CAS 54506-81-9) is a chemical compound with the molecular formula C14H11ClO2S and a molecular weight of 278.8 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfanyl-5-methylbenzoic acid. InChIKey: MNGKICVBHMOPTN-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO2S
Molecular weight278.8 g/mol
IUPAC name2-(4-chlorophenyl)sulfanyl-5-methylbenzoic acid
InChIKeyMNGKICVBHMOPTN-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)SC2=CC=C(C=C2)Cl)C(=O)O

Computed by PubChem (NCBI)