CAS 134624-91-2 appears in our catalog under these names: Phg-gly-oh, 95%, Phg-Gly-OH. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g.
2-[[(2S)-2-amino-2-phenylacetyl]amino]acetic acid (CAS 134624-91-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 2-[[(2S)-2-amino-2-phenylacetyl]amino]acetic acid. InChIKey: LJXOMNKURQBXLP-VIFPVBQESA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 2-[[(2S)-2-amino-2-phenylacetyl]amino]acetic acid |
| InChIKey | LJXOMNKURQBXLP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)NCC(=O)O)N |
Computed by PubChem (NCBI)