CAS 1346242-31-6 appears in our catalog under these names: Rivastigmine Carbamate Impurity, 3-Nitrophenyl Ethyl(methyl)carbamate, >95% (HPLC), 3-Nitrophenyl Ethyl(methyl)carbamate, Rivastigmine carbamate impurity, Rivastigmine carbamate impurity 98%. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 10g, 1g, 25mg, 5mg, 50mg, 250mg.
(3-nitrophenyl) N-ethyl-N-methylcarbamate (CAS 1346242-31-6) is a chemical compound with the molecular formula C10H12N2O4 and a molecular weight of 224.21 g/mol. IUPAC name: (3-nitrophenyl) N-ethyl-N-methylcarbamate. InChIKey: DFECCKHSYUWCIJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O4 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (3-nitrophenyl) N-ethyl-N-methylcarbamate |
| InChIKey | DFECCKHSYUWCIJ-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)