CAS 134640-85-0 appears in our catalog under these names: 2,3-DIMETHYLPHENYLMAGNESIUM BROMIDE, 0.&, 2,3–Dimethylphenylmagnesium bromide. Offered by: Sigma-Aldrich, GLPBio. Available pack sizes: 50ML, 100ml.
Magnesium;1,2-dimethylbenzene-6-ide;bromide (CAS 134640-85-0) is a chemical compound with the molecular formula C8H9BrMg and a molecular weight of 209.37 g/mol. IUPAC name: magnesium;1,2-dimethylbenzene-6-ide;bromide. InChIKey: PJYPCKZZTIAODG-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMg |
|---|---|
| Molecular weight | 209.37 g/mol |
| IUPAC name | magnesium;1,2-dimethylbenzene-6-ide;bromide |
| InChIKey | PJYPCKZZTIAODG-UHFFFAOYSA-M |
| SMILES | CC1=CC=C[C-]=C1C.[Mg+2].[Br-] |
Computed by PubChem (NCBI)