CAS 34589-46-3 is the registry number for 2,4-Dimethylphenylmagnesium bromide, 0.5M in 2-MeTHF . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 100ml.
Magnesium;1,3-dimethylbenzene-6-ide;bromide (CAS 34589-46-3) is a chemical compound with the molecular formula C8H9BrMg and a molecular weight of 209.37 g/mol. IUPAC name: magnesium;1,3-dimethylbenzene-6-ide;bromide. InChIKey: ATHZRUUXJPXJNP-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMg |
|---|---|
| Molecular weight | 209.37 g/mol |
| IUPAC name | magnesium;1,3-dimethylbenzene-6-ide;bromide |
| InChIKey | ATHZRUUXJPXJNP-UHFFFAOYSA-M |
| SMILES | CC1=CC(=[C-]C=C1)C.[Mg+2].[Br-] |
Computed by PubChem (NCBI)