CAS 22873-28-5 is the registry number for 4–Ethylphenylmagnesium bromide solution. Offered by: GLPBio. Available pack sizes: 100ml.
Magnesium;ethylbenzene;bromide (CAS 22873-28-5) is a chemical compound with the molecular formula C8H9BrMg and a molecular weight of 209.37 g/mol. IUPAC name: magnesium;ethylbenzene;bromide. InChIKey: QSGSHZBZGXYVOQ-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMg |
|---|---|
| Molecular weight | 209.37 g/mol |
| IUPAC name | magnesium;ethylbenzene;bromide |
| InChIKey | QSGSHZBZGXYVOQ-UHFFFAOYSA-M |
| SMILES | CCC1=CC=[C-]C=C1.[Mg+2].[Br-] |
Computed by PubChem (NCBI)