CAS 34696-73-6 appears in our catalog under these names: 3,5–Dimethylphenylmagnesium bromide, 3,5-Dimethylphenylmagnesium bromide, 0.5M solution in THF, AcroSeal®, 3,5-DIMETHYLPHENYLMAGNESIUM BROMIDE, 0.&. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 250ml, 50ml.
Magnesium;1,3-dimethylbenzene-5-ide;bromide (CAS 34696-73-6) is a chemical compound with the molecular formula C8H9BrMg and a molecular weight of 209.37 g/mol. IUPAC name: magnesium;1,3-dimethylbenzene-5-ide;bromide. InChIKey: UWIBIDGHIMGNRC-UHFFFAOYSA-M.
| Molecular formula | C8H9BrMg |
|---|---|
| Molecular weight | 209.37 g/mol |
| IUPAC name | magnesium;1,3-dimethylbenzene-5-ide;bromide |
| InChIKey | UWIBIDGHIMGNRC-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C[C-]=C1)C.[Mg+2].[Br-] |
Computed by PubChem (NCBI)