CAS 134652-60-1 appears in our catalog under these names: Triisopropylsilyl methacrylate, 95%, Triisopropylsilyl Methacrylate, Triisopropylsilyl methacrylate, Triisopropylsilyl methacrylate 97%, TRIISOPROPYLSILYL METHACRYLATE, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 500g.
Tri(propan-2-yl)silyl 2-methylprop-2-enoate (CAS 134652-60-1) is a chemical compound with the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. IUPAC name: tri(propan-2-yl)silyl 2-methylprop-2-enoate. InChIKey: KNNOZYMZRGTZQM-UHFFFAOYSA-N.
| Molecular formula | C13H26O2Si |
|---|---|
| Molecular weight | 242.43 g/mol |
| IUPAC name | tri(propan-2-yl)silyl 2-methylprop-2-enoate |
| InChIKey | KNNOZYMZRGTZQM-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OC(=O)C(=C)C |
Computed by PubChem (NCBI)