CAS 145912-69-2 appears in our catalog under these names: (1r,4r)-4-[(tert-Butyldimethylsilyl)oxy]cyclohexane-1-carbaldehyde, 98%, Rel-(1r,4r)-4-((tert-butyldimethylsilyl)oxy)cyclohexane-1-carbaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde (CAS 145912-69-2) is a chemical compound with the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde. InChIKey: ZGHLPKGXKPEVNB-UHFFFAOYSA-N.
| Molecular formula | C13H26O2Si |
|---|---|
| Molecular weight | 242.43 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde |
| InChIKey | ZGHLPKGXKPEVNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC1)C=O |
Computed by PubChem (NCBI)