CAS 2060028-53-5 appears in our catalog under these names: 2-{1-((tert-butyldimethylsilyl)oxy)cyclopentyl}acetaldehyde, 95%, 2-{1-((tert-Butyldimethylsilyl)oxy)cyclopentyl}acetaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]acetaldehyde (CAS 2060028-53-5) is a chemical compound with the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. IUPAC name: 2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]acetaldehyde. InChIKey: FVPREYQVYQRFHD-UHFFFAOYSA-N.
| Molecular formula | C13H26O2Si |
|---|---|
| Molecular weight | 242.43 g/mol |
| IUPAC name | 2-[1-[tert-butyl(dimethyl)silyl]oxycyclopentyl]acetaldehyde |
| InChIKey | FVPREYQVYQRFHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CCCC1)CC=O |
Computed by PubChem (NCBI)