CAS 90460-60-9 is the registry number for rac-(1R,2R)-2-((tert-Butyldimethylsilyl)oxy)cyclohexane-1-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde (CAS 90460-60-9) is a chemical compound with the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. IUPAC name: cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde. InChIKey: HTTWFXHZXOETLO-NWDGAFQWSA-N.
| Molecular formula | C13H26O2Si |
|---|---|
| Molecular weight | 242.43 g/mol |
| IUPAC name | cis-(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclohexane-1-carbaldehyde |
| InChIKey | HTTWFXHZXOETLO-NWDGAFQWSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@H]1C=O |
Computed by PubChem (NCBI)