Products 1346545-30-9

CAS 1346545-30-9 is the registry number for Benzyl 6-methylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 6-methylpyridine-3-carboxylate (CAS 1346545-30-9) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: benzyl 6-methylpyridine-3-carboxylate. InChIKey: IPQRAUYMTFBYLE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO2
Molecular weight227.26 g/mol
IUPAC namebenzyl 6-methylpyridine-3-carboxylate
InChIKeyIPQRAUYMTFBYLE-UHFFFAOYSA-N
SMILESCC1=NC=C(C=C1)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)