Products 1346598-00-2
CAS 1346598-00-2 is the registry number for rac Dehydro-o-desmethyl venlafaxine-d6. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
4-[2-[bis(trideuteriomethyl)amino]-1-(cyclohexen-1-yl)ethyl]phenol (CAS 1346598-00-2) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 251.40 g/mol. IUPAC name: 4-[2-[bis(trideuteriomethyl)amino]-1-(cyclohexen-1-yl)ethyl]phenol. InChIKey: TZCZNCWNSMBGJC-WFGJKAKNSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 251.40 g/mol |
| IUPAC name | 4-[2-[bis(trideuteriomethyl)amino]-1-(cyclohexen-1-yl)ethyl]phenol |
| InChIKey | TZCZNCWNSMBGJC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(C1=CCCCC1)C2=CC=C(C=C2)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)