Products 1346600-18-7
CAS 1346600-18-7 is the registry number for Mono(4-hydroxypentyl)phthalate-d4. Offered by: TRC. Available pack sizes: 50mg.
2,3,4,5-tetradeuterio-6-(4-hydroxypentoxycarbonyl)benzoic acid (CAS 1346600-18-7) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 256.29 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(4-hydroxypentoxycarbonyl)benzoic acid. InChIKey: PDIKFAUTXCJYHZ-USSMZTJJSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 256.29 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(4-hydroxypentoxycarbonyl)benzoic acid |
| InChIKey | PDIKFAUTXCJYHZ-USSMZTJJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC(C)O)[2H])[2H] |
Computed by PubChem (NCBI)