CAS 1346600-40-5 appears in our catalog under these names: 3-Fluoroephedrone Hydrochloride, >95% (HPLC), 3-Fluoromethcathinone Hydrochloride (1-(3-Fluorophenyl)-2-(methylamino)propan-1-one Hydrochloride), 3-Fluoromethcathinone Hydrochloride (1-(3-Fluorophenyl)-2-(methylamino)propan-1-one Hydrochloride) 1.0 mg/ml in Dimethyl Sulfoxide (as free base), 3-Fluoroephedrone Hydrochloride. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 1ml, 25mg.
1-(3-fluorophenyl)-2-(methylamino)propan-1-one;hydrochloride (CAS 1346600-40-5) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: 1-(3-fluorophenyl)-2-(methylamino)propan-1-one;hydrochloride. InChIKey: NPLXZPCXIHEMMH-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2-(methylamino)propan-1-one;hydrochloride |
| InChIKey | NPLXZPCXIHEMMH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)F)NC.Cl |
Computed by PubChem (NCBI)