Products 1794737-49-7
CAS 1794737-49-7 is the registry number for 3-Fluoroephedrone-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
1-(3-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride (CAS 1794737-49-7) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 220.68 g/mol. IUPAC name: 1-(3-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride. InChIKey: NPLXZPCXIHEMMH-MUTAZJQDSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2-(trideuteriomethylamino)propan-1-one;hydrochloride |
| InChIKey | NPLXZPCXIHEMMH-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])NC(C)C(=O)C1=CC(=CC=C1)F.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Fluoroephedrone-d3 Hydrochloride