Products 1346601-93-1
CAS 1346601-93-1 is the registry number for Citalopram Nitrile Oxide. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile oxide (CAS 1346601-93-1) is a chemical compound with the molecular formula C20H21FN2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile oxide. InChIKey: WVTNHLAXBFGVJR-UHFFFAOYSA-N.
| Molecular formula | C20H21FN2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile oxide |
| InChIKey | WVTNHLAXBFGVJR-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#[N+][O-])C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
Citalopram Nitrile Oxide, CitalopramNitrileOxide