Products 411221-53-9
CAS 411221-53-9 appears in our catalog under these names: 1-(3-(Dimethylamino)propyl)-1-(4-fluorophenyl)-3-hydroxy-1,3-dihydroisobenzofuran-5-carbonitrile, 97%, Citalopram Impurity 4（Citalopram EP Impurity B）, Citalopram EP Impurity B,EsCitalopram EP Impurity B, 3-Hydroxy Citalopram, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3-hydroxy-3H-2-benzofuran-5-carbonitrile (CAS 411221-53-9) is a chemical compound with the molecular formula C20H21FN2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3-hydroxy-3H-2-benzofuran-5-carbonitrile. InChIKey: LJPQJFHBFOOIHE-UHFFFAOYSA-N.
| Molecular formula | C20H21FN2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3-hydroxy-3H-2-benzofuran-5-carbonitrile |
| InChIKey | LJPQJFHBFOOIHE-UHFFFAOYSA-N |
| SMILES | CN(C)CCCC1(C2=C(C=C(C=C2)C#N)C(O1)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxy Citalopram, Citalopram EP Impurity B, Citalopram hydrobromide impurity B [EP], Citalopram hydrochloride impurity B [EP], starbld0029260, Citalopram hydrobromide specified impurity B [EP], Citalopram hydrochloride specified impurity B [EP], Citalopram EP Impurity B; Escitalopram EP Impurity B, Citalopram EP Impurity B (Escitalopram EP Impurity B ), CITALOPRAM HYDROBROMIDE IMPURITY B [EP IMPURITY]