Products 917482-45-2
CAS 917482-45-2 appears in our catalog under these names: Citalopram Impurity 30, (S)-Citalopram N-Oxide (Escitalopram N-Oxide), (S)-Citalopram N-Oxide, >95% (HPLC), Escitalopram N-Oxide. Offered by: Hubei YoungXin, Chemat Brand, TRC, Mikromol. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg.
3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine oxide (CAS 917482-45-2) is a chemical compound with the molecular formula C20H21FN2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine oxide. InChIKey: DIOGFDCEWUUSBQ-FQEVSTJZSA-N.
| Molecular formula | C20H21FN2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-[(1S)-5-cyano-1-(4-fluorophenyl)-3H-2-benzofuran-1-yl]-N,N-dimethylpropan-1-amine oxide |
| InChIKey | DIOGFDCEWUUSBQ-FQEVSTJZSA-N |
| SMILES | C[N+](C)(CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F)[O-] |
Computed by PubChem (NCBI)