Products 1374107-46-6
CAS 1374107-46-6 is the registry number for THK-5105. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-[4-(dimethylamino)phenyl]quinolin-6-yl]oxy-3-fluoropropan-2-ol (CAS 1374107-46-6) is a chemical compound with the molecular formula C20H21FN2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 1-[2-[4-(dimethylamino)phenyl]quinolin-6-yl]oxy-3-fluoropropan-2-ol. InChIKey: YECXMTCPEPHEAA-UHFFFAOYSA-N.
| Molecular formula | C20H21FN2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 1-[2-[4-(dimethylamino)phenyl]quinolin-6-yl]oxy-3-fluoropropan-2-ol |
| InChIKey | YECXMTCPEPHEAA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)OCC(CF)O |
Computed by PubChem (NCBI)