CAS 1346604-00-9 appears in our catalog under these names: Bisoprolol EP Impurity Q, Bisoprolol Impurity 13(Bisoprolol EP Impurity Q), O-Desisopropyl-O-methyl Bisoprolol Hemifumarate, >95% (HPLC), (2RS)-1-(Isopropylamino)-3-(4-(2-methoxyethoxy)methylphenoxy)propan-2-ol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 4x25mg.
1-[4-(2-methoxyethoxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (CAS 1346604-00-9) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 1-[4-(2-methoxyethoxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol. InChIKey: QEWDDLNGKAKJOA-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 1-[4-(2-methoxyethoxymethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChIKey | QEWDDLNGKAKJOA-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)COCCOC)O |
Computed by PubChem (NCBI)