CAS 1346604-52-1 appears in our catalog under these names: 4-Acetamidobenzenesulphinic Acid-d4, 4-Acetamidobenzene-2,3,5,6-d4-sulfinic acid. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
4-acetamido-2,3,5,6-tetradeuteriobenzenesulfinic acid (CAS 1346604-52-1) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 203.25 g/mol. IUPAC name: 4-acetamido-2,3,5,6-tetradeuteriobenzenesulfinic acid. InChIKey: YDQNDKBOOVXRTL-QFFDRWTDSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | 4-acetamido-2,3,5,6-tetradeuteriobenzenesulfinic acid |
| InChIKey | YDQNDKBOOVXRTL-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])S(=O)O)[2H] |
Computed by PubChem (NCBI)