CAS 1346605-03-5 appears in our catalog under these names: Phenelzine-d4 Sulfate, >95% (HPLC), Phenelzine-d4 sulfate. Offered by: TRC, Biosynth. Available pack sizes: 2,5mg, 25mg, 50mg.
Sulfuric acid;(1,1,2,2-tetradeuterio-2-phenylethyl)hydrazine (CAS 1346605-03-5) is a chemical compound with the molecular formula C8H14N2O4S and a molecular weight of 238.30 g/mol. IUPAC name: sulfuric acid;(1,1,2,2-tetradeuterio-2-phenylethyl)hydrazine. InChIKey: RXBKMJIPNDOHFR-FEUVXQGESA-N.
| Molecular formula | C8H14N2O4S |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | sulfuric acid;(1,1,2,2-tetradeuterio-2-phenylethyl)hydrazine |
| InChIKey | RXBKMJIPNDOHFR-FEUVXQGESA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)C([2H])([2H])NN.OS(=O)(=O)O |
Computed by PubChem (NCBI)