CAS 1795786-57-0 appears in our catalog under these names: N-Acetyl-S-(carbamoylethyl)-L-cysteine-d3, >95% (HPLC), N–Acetyl–S–(carbamoylethyl)–L–cysteine–d3, N-Acetyl-S-(carbamoylethyl)-L-cysteine-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
(2R)-3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid (CAS 1795786-57-0) is a chemical compound with the molecular formula C8H14N2O4S and a molecular weight of 237.29 g/mol. IUPAC name: (2R)-3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid. InChIKey: GGBCHNJZQQEQRX-FYFSCIFKSA-N.
| Molecular formula | C8H14N2O4S |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | (2R)-3-(3-amino-3-oxopropyl)sulfanyl-2-[(2,2,2-trideuterioacetyl)amino]propanoic acid |
| InChIKey | GGBCHNJZQQEQRX-FYFSCIFKSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@@H](CSCCC(=O)N)C(=O)O |
Computed by PubChem (NCBI)