Products 225233-98-7

CAS 225233-98-7 is the registry number for S-Nitroso-N-propionyl-D,L-penicillamine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

3-methyl-3-nitrososulfanyl-2-(propanoylamino)butanoic acid (CAS 225233-98-7) is a chemical compound with the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. IUPAC name: 3-methyl-3-nitrososulfanyl-2-(propanoylamino)butanoic acid. InChIKey: XRIWLEWQNCECEP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14N2O4S
Molecular weight234.28 g/mol
IUPAC name3-methyl-3-nitrososulfanyl-2-(propanoylamino)butanoic acid
InChIKeyXRIWLEWQNCECEP-UHFFFAOYSA-N
SMILESCCC(=O)NC(C(=O)O)C(C)(C)SN=O

Computed by PubChem (NCBI)