Products 6219-73-4
CAS 6219-73-4 is the registry number for N,N-Dimethyl-p-phenylenediamine sulfate. Offered by: Biosynth. Available pack sizes: 500g, 250g.
4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid (CAS 6219-73-4) is a chemical compound with the molecular formula C8H14N2O4S and a molecular weight of 234.28 g/mol. IUPAC name: 4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid. InChIKey: GLUKPDKNLKRLHX-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O4S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 4-N,4-N-dimethylbenzene-1,4-diamine;sulfuric acid |
| InChIKey | GLUKPDKNLKRLHX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
N,N-Dimethyl-p-phenylenediamine sulfate, 1,4-Benzenediamine, N,N-dimethyl-, sulfate, DURAFUR GREY N, FOURAMINE GREY AL, 4-Amino-N,N-dimethylaniline sulphate, BASF URSOL GREY DM, BASF URSOL GREY DMG, FOURRINE BLUE GREY R, p-Phenylenediamine, N,N-dimethyl-, sulfate, N,N-dimethylbenzene-1,4-diammonium sulphate