Products 1346606-26-5
CAS 1346606-26-5 appears in our catalog under these names: all-trans 4-Keto Retinoic Acid-(9-methyl)-d3, 4-Oxoretinoic acid-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(2E,4E,6E,8E)-3-methyl-7-(trideuteriomethyl)-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid (CAS 1346606-26-5) is a chemical compound with the molecular formula C20H26O3 and a molecular weight of 317.4 g/mol. IUPAC name: (2E,4E,6E,8E)-3-methyl-7-(trideuteriomethyl)-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid. InChIKey: GGCUJPCCTQNTJF-LMOMAJEASA-N.
| Molecular formula | C20H26O3 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (2E,4E,6E,8E)-3-methyl-7-(trideuteriomethyl)-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid |
| InChIKey | GGCUJPCCTQNTJF-LMOMAJEASA-N |
| SMILES | [2H]C([2H])([2H])/C(=C\C=C\C(=C\C(=O)O)\C)/C=C/C1=C(C(=O)CCC1(C)C)C |
Computed by PubChem (NCBI)