Products 1346606-43-6
CAS 1346606-43-6 is the registry number for Dehydro warfarin-d5. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
4-hydroxy-3-[(E)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)but-1-enyl]chromen-2-one (CAS 1346606-43-6) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 311.3 g/mol. IUPAC name: 4-hydroxy-3-[(E)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)but-1-enyl]chromen-2-one. InChIKey: SWIPQYPHTPMNLK-JCWZGFGXSA-N.
| Molecular formula | C19H14O4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 4-hydroxy-3-[(E)-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)but-1-enyl]chromen-2-one |
| InChIKey | SWIPQYPHTPMNLK-JCWZGFGXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])/C(=C\C(=O)C)/C2=C(C3=CC=CC=C3OC2=O)O)[2H])[2H] |
Computed by PubChem (NCBI)