CAS 282730-62-5 is the registry number for 2-Oxo-2-phenylethyl 3-hydroxy-2-naphthoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Phenacyl 3-hydroxynaphthalene-2-carboxylate (CAS 282730-62-5) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 306.3 g/mol. IUPAC name: phenacyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: FFXRDUPWVUFPJU-UHFFFAOYSA-N.
| Molecular formula | C19H14O4 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | phenacyl 3-hydroxynaphthalene-2-carboxylate |
| InChIKey | FFXRDUPWVUFPJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)COC(=O)C2=CC3=CC=CC=C3C=C2O |
Computed by PubChem (NCBI)