Products 282730-62-5

CAS 282730-62-5 is the registry number for 2-Oxo-2-phenylethyl 3-hydroxy-2-naphthoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Phenacyl 3-hydroxynaphthalene-2-carboxylate (CAS 282730-62-5) is a chemical compound with the molecular formula C19H14O4 and a molecular weight of 306.3 g/mol. IUPAC name: phenacyl 3-hydroxynaphthalene-2-carboxylate. InChIKey: FFXRDUPWVUFPJU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H14O4
Molecular weight306.3 g/mol
IUPAC namephenacyl 3-hydroxynaphthalene-2-carboxylate
InChIKeyFFXRDUPWVUFPJU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)COC(=O)C2=CC3=CC=CC=C3C=C2O

Computed by PubChem (NCBI)